About 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid
4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid (PubChem CID 82378280) has the molecular formula C11H10ClNO4S
and a molecular weight of 287.72 g/mol. Its IUPAC name is 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid |
| PubChem CID | 82378280 |
| Molecular Formula | C11H10ClNO4S |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)Cl)c2cc(C(=O)O)[nH]c2c1C |
| InChI | InChI=1S/C11H10ClNO4S/c1-5-3-9(18(12,16)17)7-4-8(11(14)15)13-10(7)6(5)2/h3-4,13H,1-2H3,(H,14,15) |
| InChIKey | CSXJPQKTPMPEMB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid?
The IUPAC name of 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid (CID 82378280) is 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid.
What is the SMILES notation for 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid?
The canonical SMILES for 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid is Cc1cc(S(=O)(=O)Cl)c2cc(C(=O)O)[nH]c2c1C.
What is the InChIKey of 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid?
The InChIKey is CSXJPQKTPMPEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO4S/c1-5-3-9(18(12,16)17)7-4-8(11(14)15)13-10(7)6(5)2/h3-4,13H,1-2H3,(H,14,15).
What are the key properties of 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid?
4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid has a molecular weight of 287.72 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorosulfonyl-6,7-dimethyl-1H-indole-2-carboxylic acid is sourced from PubChem (CID 82378280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).