C15H16N4 — CID 82382236
[5-(2,5-dimethylindolizin-3-yl)pyridazin-4-yl]methanamine (PubChem CID 82382236) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is [5-(2,5-dimethylindolizin-3-yl)pyridazin-4-yl]methanamine.
| Compound Name | [5-(2,5-dimethylindolizin-3-yl)pyridazin-4-yl]methanamine |
|---|---|
| PubChem CID | 82382236 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [5-(2,5-dimethylindolizin-3-yl)pyridazin-4-yl]methanamine |
| SMILES | Cc1cc2cccc(C)n2c1-c1cnncc1CN |
| InChI | InChI=1S/C15H16N4/c1-10-6-13-5-3-4-11(2)19(13)15(10)14-9-18-17-8-12(14)7-16/h3-6,8-9H,7,16H2,1-2H3 |
| InChIKey | YAYSAPURSLLJIA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |