C12H16N4O2 — CID 82383496
6-(1-aminopiperidin-2-yl)-1-methyl-[1,3]oxazolo[5,4-b]pyridin-2-one (PubChem CID 82383496) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 6-(1-aminopiperidin-2-yl)-1-methyl-[1,3]oxazolo[5,4-b]pyridin-2-one.
| Compound Name | 6-(1-aminopiperidin-2-yl)-1-methyl-[1,3]oxazolo[5,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 82383496 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-(1-aminopiperidin-2-yl)-1-methyl-[1,3]oxazolo[5,4-b]pyridin-2-one |
| SMILES | Cn1c(=O)oc2ncc(C3CCCCN3N)cc21 |
| InChI | InChI=1S/C12H16N4O2/c1-15-10-6-8(7-14-11(10)18-12(15)17)9-4-2-3-5-16(9)13/h6-7,9H,2-5,13H2,1H3 |
| InChIKey | JPOVZRFUFKAYRL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|