C13H12FN3O — CID 82385260
[5-(6-fluoro-1-methylindol-2-yl)-1,3-oxazol-2-yl]methanamine (PubChem CID 82385260) has the molecular formula C13H12FN3O and a molecular weight of 245.26 g/mol. Its IUPAC name is [5-(6-fluoro-1-methylindol-2-yl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(6-fluoro-1-methylindol-2-yl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 82385260 |
| Molecular Formula | C13H12FN3O |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | [5-(6-fluoro-1-methylindol-2-yl)-1,3-oxazol-2-yl]methanamine |
| SMILES | Cn1c(-c2cnc(CN)o2)cc2ccc(F)cc21 |
| InChI | InChI=1S/C13H12FN3O/c1-17-10-5-9(14)3-2-8(10)4-11(17)12-7-16-13(6-15)18-12/h2-5,7H,6,15H2,1H3 |
| InChIKey | BKBJHVCUTFLREH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |