C14H11BrN2O — CID 113292812
[5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]methanamine (PubChem CID 113292812) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is [5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]methanamine.
| Compound Name | [5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]methanamine |
|---|---|
| PubChem CID | 113292812 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | [5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]methanamine |
| SMILES | NCc1ncc(-c2ccc3cc(Br)ccc3c2)o1 |
| InChI | InChI=1S/C14H11BrN2O/c15-12-4-3-9-5-11(2-1-10(9)6-12)13-8-17-14(7-16)18-13/h1-6,8H,7,16H2 |
| InChIKey | ABIPORNRQQWWRH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |