C15H13BrN2O — CID 115354580
2-[5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 115354580) has the molecular formula C15H13BrN2O and a molecular weight of 317.19 g/mol. Its IUPAC name is 2-[5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 115354580 |
| Molecular Formula | C15H13BrN2O |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[5-(6-bromonaphthalen-2-yl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | NCCc1ncc(-c2ccc3cc(Br)ccc3c2)o1 |
| InChI | InChI=1S/C15H13BrN2O/c16-13-4-3-10-7-12(2-1-11(10)8-13)14-9-18-15(19-14)5-6-17/h1-4,7-9H,5-6,17H2 |
| InChIKey | YERHCWAURCSPEG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |