About N-(2-chloro-1,3-benzoxazol-4-yl)acetamide
N-(2-chloro-1,3-benzoxazol-4-yl)acetamide (PubChem CID 82394758) has the molecular formula C9H7ClN2O2
and a molecular weight of 210.62 g/mol. Its IUPAC name is N-(2-chloro-1,3-benzoxazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-chloro-1,3-benzoxazol-4-yl)acetamide |
| PubChem CID | 82394758 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | N-(2-chloro-1,3-benzoxazol-4-yl)acetamide |
| SMILES | CC(=O)Nc1cccc2oc(Cl)nc12 |
| InChI | InChI=1S/C9H7ClN2O2/c1-5(13)11-6-3-2-4-7-8(6)12-9(10)14-7/h2-4H,1H3,(H,11,13) |
| InChIKey | CSNRIOPBKDMYIS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chloro-1,3-benzoxazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-1,3-benzoxazol-4-yl)acetamide?
The IUPAC name of N-(2-chloro-1,3-benzoxazol-4-yl)acetamide (CID 82394758) is N-(2-chloro-1,3-benzoxazol-4-yl)acetamide.
What is the SMILES notation for N-(2-chloro-1,3-benzoxazol-4-yl)acetamide?
The canonical SMILES for N-(2-chloro-1,3-benzoxazol-4-yl)acetamide is CC(=O)Nc1cccc2oc(Cl)nc12.
What is the InChIKey of N-(2-chloro-1,3-benzoxazol-4-yl)acetamide?
The InChIKey is CSNRIOPBKDMYIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c1-5(13)11-6-3-2-4-7-8(6)12-9(10)14-7/h2-4H,1H3,(H,11,13).
What are the key properties of N-(2-chloro-1,3-benzoxazol-4-yl)acetamide?
N-(2-chloro-1,3-benzoxazol-4-yl)acetamide has a molecular weight of 210.62 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-1,3-benzoxazol-4-yl)acetamide is sourced from PubChem (CID 82394758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).