C10H11N3OS — CID 169356447
(2-ethyl-1,3-benzoxazol-4-yl)thiourea (PubChem CID 169356447) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is (2-ethyl-1,3-benzoxazol-4-yl)thiourea.
| Compound Name | (2-ethyl-1,3-benzoxazol-4-yl)thiourea |
|---|---|
| PubChem CID | 169356447 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | (2-ethyl-1,3-benzoxazol-4-yl)thiourea |
| SMILES | CCc1nc2c(NC(N)=S)cccc2o1 |
| InChI | InChI=1S/C10H11N3OS/c1-2-8-13-9-6(12-10(11)15)4-3-5-7(9)14-8/h3-5H,2H2,1H3,(H3,11,12,15) |
| InChIKey | FYWHMCFYHDQQAX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|