C10H10N2O3 — CID 131332888
methyl 2-(4-amino-1,3-benzoxazol-2-yl)acetate (PubChem CID 131332888) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 2-(4-amino-1,3-benzoxazol-2-yl)acetate.
| Compound Name | methyl 2-(4-amino-1,3-benzoxazol-2-yl)acetate |
|---|---|
| PubChem CID | 131332888 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl 2-(4-amino-1,3-benzoxazol-2-yl)acetate |
| SMILES | COC(=O)Cc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C10H10N2O3/c1-14-9(13)5-8-12-10-6(11)3-2-4-7(10)15-8/h2-4H,5,11H2,1H3 |
| InChIKey | ZQBRWFILVPLWAZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|