About 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid
2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid (PubChem CID 82398939) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid.
Analyze 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid?
The IUPAC name of 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid (CID 82398939) is 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid.
What is the SMILES notation for 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid?
The canonical SMILES for 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid is Cc1cn(C)nc1CC(CN)C(=O)O.
What is the InChIKey of 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid?
The InChIKey is RKZKEYXJLQTCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6-5-12(2)11-8(6)3-7(4-10)9(13)14/h5,7H,3-4,10H2,1-2H3,(H,13,14).
What are the key properties of 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid?
2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid has a molecular weight of 197.24 g/mol, XLogP of -0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-(1,4-dimethylpyrazol-3-yl)propanoic acid is sourced from PubChem (CID 82398939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).