C7H12N4O2 — CID 82406730
2-(aminomethyl)-3-(5-methyl-2H-triazol-4-yl)propanoic acid (PubChem CID 82406730) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(5-methyl-2H-triazol-4-yl)propanoic acid.
| Compound Name | 2-(aminomethyl)-3-(5-methyl-2H-triazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 82406730 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(aminomethyl)-3-(5-methyl-2H-triazol-4-yl)propanoic acid |
| SMILES | Cc1n[nH]nc1CC(CN)C(=O)O |
| InChI | InChI=1S/C7H12N4O2/c1-4-6(10-11-9-4)2-5(3-8)7(12)13/h5H,2-3,8H2,1H3,(H,12,13)(H,9,10,11) |
| InChIKey | LFURCIRUVRNQEQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |