2-(aminomethyl)-3-fluoropropanoic acid

C4H8FNO2 — CID 20508331

IUPAC2-(aminomethyl)-3-fluoropropanoic acid
SMILESNCC(CF)C(=O)O
InChIInChI=1S/C4H8FNO2/c5-1-3(2-6)4(7)8/h3H,1-2,6H2,(H,7,8)
InChIKeyZFSJYFYFBKKKSF-UHFFFAOYSA-N
MW121.11 g/mol
LogP-0.38
Rot. Bonds3

About 2-(aminomethyl)-3-fluoropropanoic acid

2-(aminomethyl)-3-fluoropropanoic acid (PubChem CID 20508331) has the molecular formula C4H8FNO2 and a molecular weight of 121.11 g/mol. Its IUPAC name is 2-(aminomethyl)-3-fluoropropanoic acid.

Molecular Properties

Compound Name2-(aminomethyl)-3-fluoropropanoic acid
PubChem CID20508331
Molecular FormulaC4H8FNO2
Molecular Weight121.11 g/mol
Exact Mass121.05
IUPAC Name2-(aminomethyl)-3-fluoropropanoic acid
SMILESNCC(CF)C(=O)O
InChIInChI=1S/C4H8FNO2/c5-1-3(2-6)4(7)8/h3H,1-2,6H2,(H,7,8)
InChIKeyZFSJYFYFBKKKSF-UHFFFAOYSA-N
XLogP-0.38
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500121.11
LogP ≤ 5-0.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(aminomethyl)-3-fluoropropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(aminomethyl)-3-fluoropropanoic acid?
The IUPAC name of 2-(aminomethyl)-3-fluoropropanoic acid (CID 20508331) is 2-(aminomethyl)-3-fluoropropanoic acid.
What is the SMILES notation for 2-(aminomethyl)-3-fluoropropanoic acid?
The canonical SMILES for 2-(aminomethyl)-3-fluoropropanoic acid is NCC(CF)C(=O)O.
What is the InChIKey of 2-(aminomethyl)-3-fluoropropanoic acid?
The InChIKey is ZFSJYFYFBKKKSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FNO2/c5-1-3(2-6)4(7)8/h3H,1-2,6H2,(H,7,8).
What are the key properties of 2-(aminomethyl)-3-fluoropropanoic acid?
2-(aminomethyl)-3-fluoropropanoic acid has a molecular weight of 121.11 g/mol, XLogP of -0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-fluoropropanoic acid is sourced from PubChem (CID 20508331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).