2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid

C7H11N3O3 — CID 82406292

IUPAC2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid
SMILESCc1nnc(CC(CN)C(=O)O)o1
InChIInChI=1S/C7H11N3O3/c1-4-9-10-6(13-4)2-5(3-8)7(11)12/h5H,2-3,8H2,1H3,(H,11,12)
InChIKeyHTDNJZRGYACYDE-UHFFFAOYSA-N
MW185.18 g/mol
LogP-0.42
Rot. Bonds4

About 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid

2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid (PubChem CID 82406292) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid.

Molecular Properties

Compound Name2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid
PubChem CID82406292
Molecular FormulaC7H11N3O3
Molecular Weight185.18 g/mol
Exact Mass185.08
IUPAC Name2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid
SMILESCc1nnc(CC(CN)C(=O)O)o1
InChIInChI=1S/C7H11N3O3/c1-4-9-10-6(13-4)2-5(3-8)7(11)12/h5H,2-3,8H2,1H3,(H,11,12)
InChIKeyHTDNJZRGYACYDE-UHFFFAOYSA-N
XLogP-0.42
TPSA102.24 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.18
LogP ≤ 5-0.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid?
The IUPAC name of 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid (CID 82406292) is 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid.
What is the SMILES notation for 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid?
The canonical SMILES for 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid is Cc1nnc(CC(CN)C(=O)O)o1.
What is the InChIKey of 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid?
The InChIKey is HTDNJZRGYACYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O3/c1-4-9-10-6(13-4)2-5(3-8)7(11)12/h5H,2-3,8H2,1H3,(H,11,12).
What are the key properties of 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid?
2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid has a molecular weight of 185.18 g/mol, XLogP of -0.42, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-(5-methyl-1,3,4-oxadiazol-2-yl)propanoic acid is sourced from PubChem (CID 82406292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).