C9H15N3O2 — CID 82398962
1-[(3-amino-1,2-oxazol-5-yl)methyl]piperidin-3-ol (PubChem CID 82398962) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-[(3-amino-1,2-oxazol-5-yl)methyl]piperidin-3-ol.
| Compound Name | 1-[(3-amino-1,2-oxazol-5-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 82398962 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-[(3-amino-1,2-oxazol-5-yl)methyl]piperidin-3-ol |
| SMILES | Nc1cc(CN2CCCC(O)C2)on1 |
| InChI | InChI=1S/C9H15N3O2/c10-9-4-8(14-11-9)6-12-3-1-2-7(13)5-12/h4,7,13H,1-3,5-6H2,(H2,10,11) |
| InChIKey | KSWSPEIBMLGIEK-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |