C10H16N2O2 — CID 82399553
4-amino-1,9-dioxaspiro[5.5]undecane-4-carbonitrile (PubChem CID 82399553) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-amino-1,9-dioxaspiro[5.5]undecane-4-carbonitrile.
| Compound Name | 4-amino-1,9-dioxaspiro[5.5]undecane-4-carbonitrile |
|---|---|
| PubChem CID | 82399553 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-amino-1,9-dioxaspiro[5.5]undecane-4-carbonitrile |
| SMILES | N#CC1(N)CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C10H16N2O2/c11-8-9(12)1-6-14-10(7-9)2-4-13-5-3-10/h1-7,12H2 |
| InChIKey | HZSLFWSSSZJBLJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |