C10H13NO3 — CID 82400550
2-amino-1-(3,4-dihydroxyphenyl)butan-1-one (PubChem CID 82400550) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-amino-1-(3,4-dihydroxyphenyl)butan-1-one.
| Compound Name | 2-amino-1-(3,4-dihydroxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 82400550 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 2-amino-1-(3,4-dihydroxyphenyl)butan-1-one |
| SMILES | CCC(N)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H13NO3/c1-2-7(11)10(14)6-3-4-8(12)9(13)5-6/h3-5,7,12-13H,2,11H2,1H3 |
| InChIKey | SRELCPJJZUFVLV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|