C10H14N4 — CID 82403859
1-(3-methylbenzimidazol-5-yl)ethane-1,2-diamine (PubChem CID 82403859) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(3-methylbenzimidazol-5-yl)ethane-1,2-diamine.
| Compound Name | 1-(3-methylbenzimidazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82403859 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-(3-methylbenzimidazol-5-yl)ethane-1,2-diamine |
| SMILES | Cn1cnc2ccc(C(N)CN)cc21 |
| InChI | InChI=1S/C10H14N4/c1-14-6-13-9-3-2-7(4-10(9)14)8(12)5-11/h2-4,6,8H,5,11-12H2,1H3 |
| InChIKey | FBEVLFSAQKSMBC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |