C11H15N3 — CID 84771244
2-(1-methylpyrrolo[3,2-b]pyridin-6-yl)propan-1-amine (PubChem CID 84771244) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(1-methylpyrrolo[3,2-b]pyridin-6-yl)propan-1-amine.
| Compound Name | 2-(1-methylpyrrolo[3,2-b]pyridin-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 84771244 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(1-methylpyrrolo[3,2-b]pyridin-6-yl)propan-1-amine |
| SMILES | CC(CN)c1cnc2ccn(C)c2c1 |
| InChI | InChI=1S/C11H15N3/c1-8(6-12)9-5-11-10(13-7-9)3-4-14(11)2/h3-5,7-8H,6,12H2,1-2H3 |
| InChIKey | WPQDDGYCPGXPIL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|