C11H14N2O — CID 82403983
1-(1,3-benzoxazol-7-yl)butan-1-amine (PubChem CID 82403983) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-7-yl)butan-1-amine.
| Compound Name | 1-(1,3-benzoxazol-7-yl)butan-1-amine |
|---|---|
| PubChem CID | 82403983 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(1,3-benzoxazol-7-yl)butan-1-amine |
| SMILES | CCCC(N)c1cccc2ncoc12 |
| InChI | InChI=1S/C11H14N2O/c1-2-4-9(12)8-5-3-6-10-11(8)14-7-13-10/h3,5-7,9H,2,4,12H2,1H3 |
| InChIKey | PHLOPVLYHYBAOU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |