C10H12N4 — CID 82404941
5-pyrrolidin-3-yl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 82404941) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-pyrrolidin-3-yl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-pyrrolidin-3-yl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 82404941 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 5-pyrrolidin-3-yl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | c1cc(C2CCNC2)n2ncnc2c1 |
| InChI | InChI=1S/C10H12N4/c1-2-9(8-4-5-11-6-8)14-10(3-1)12-7-13-14/h1-3,7-8,11H,4-6H2 |
| InChIKey | OKBRKIPKVFBEDS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |