About 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one
4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one (PubChem CID 82406541) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one.
Molecular Properties
| Compound Name | 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one |
| PubChem CID | 82406541 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one |
| SMILES | Cc1nc(C(=O)CCCN)cs1 |
| InChI | InChI=1S/C8H12N2OS/c1-6-10-7(5-12-6)8(11)3-2-4-9/h5H,2-4,9H2,1H3 |
| InChIKey | HIHHRSMGBQNGLR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one?
The IUPAC name of 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one (CID 82406541) is 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one.
What is the SMILES notation for 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one?
The canonical SMILES for 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one is Cc1nc(C(=O)CCCN)cs1.
What is the InChIKey of 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one?
The InChIKey is HIHHRSMGBQNGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c1-6-10-7(5-12-6)8(11)3-2-4-9/h5H,2-4,9H2,1H3.
What are the key properties of 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one?
4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one has a molecular weight of 184.26 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-(2-methyl-1,3-thiazol-4-yl)butan-1-one is sourced from PubChem (CID 82406541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).