C6H8N2OS — CID 67967921
1-[2-(aminomethyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 67967921) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(aminomethyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 67967921 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1-[2-(aminomethyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C6H8N2OS/c1-4(9)5-3-10-6(2-7)8-5/h3H,2,7H2,1H3 |
| InChIKey | CNJFHGYGOBIRRY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |