C9H12N2S — CID 82408720
3-(1,2-thiazol-4-yl)bicyclo[3.1.0]hexan-3-amine (PubChem CID 82408720) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 3-(1,2-thiazol-4-yl)bicyclo[3.1.0]hexan-3-amine.
| Compound Name | 3-(1,2-thiazol-4-yl)bicyclo[3.1.0]hexan-3-amine |
|---|---|
| PubChem CID | 82408720 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3-(1,2-thiazol-4-yl)bicyclo[3.1.0]hexan-3-amine |
| SMILES | NC1(c2cnsc2)CC2CC2C1 |
| InChI | InChI=1S/C9H12N2S/c10-9(8-4-11-12-5-8)2-6-1-7(6)3-9/h4-7H,1-3,10H2 |
| InChIKey | YNAAWHZAFAHKIF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |