C10H16N2O — CID 82408866
4-(4-methyl-1,3-oxazol-2-yl)cyclohexan-1-amine (PubChem CID 82408866) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(4-methyl-1,3-oxazol-2-yl)cyclohexan-1-amine.
| Compound Name | 4-(4-methyl-1,3-oxazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 82408866 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-(4-methyl-1,3-oxazol-2-yl)cyclohexan-1-amine |
| SMILES | Cc1coc(C2CCC(N)CC2)n1 |
| InChI | InChI=1S/C10H16N2O/c1-7-6-13-10(12-7)8-2-4-9(11)5-3-8/h6,8-9H,2-5,11H2,1H3 |
| InChIKey | BBBGVVIQFNXVMQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |