4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid

C7H8N2O3 — CID 82413478

IUPAC4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid
SMILESCN1CCc2onc(C(=O)O)c21
InChIInChI=1S/C7H8N2O3/c1-9-3-2-4-6(9)5(7(10)11)8-12-4/h2-3H2,1H3,(H,10,11)
InChIKeyHWQQSRVQTHHCRJ-UHFFFAOYSA-N
MW168.15 g/mol
LogP0.37
Rot. Bonds1

About 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid

4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid (PubChem CID 82413478) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid.

Molecular Properties

Compound Name4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid
PubChem CID82413478
Molecular FormulaC7H8N2O3
Molecular Weight168.15 g/mol
Exact Mass168.05
IUPAC Name4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid
SMILESCN1CCc2onc(C(=O)O)c21
InChIInChI=1S/C7H8N2O3/c1-9-3-2-4-6(9)5(7(10)11)8-12-4/h2-3H2,1H3,(H,10,11)
InChIKeyHWQQSRVQTHHCRJ-UHFFFAOYSA-N
XLogP0.37
TPSA66.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 50.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
The IUPAC name of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid (CID 82413478) is 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid.
What is the SMILES notation for 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
The canonical SMILES for 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid is CN1CCc2onc(C(=O)O)c21.
What is the InChIKey of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
The InChIKey is HWQQSRVQTHHCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-9-3-2-4-6(9)5(7(10)11)8-12-4/h2-3H2,1H3,(H,10,11).
What are the key properties of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid is sourced from PubChem (CID 82413478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).