About 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid
4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid (PubChem CID 82413478) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid.
Analyze 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
The IUPAC name of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid (CID 82413478) is 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid.
What is the SMILES notation for 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
The canonical SMILES for 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid is CN1CCc2onc(C(=O)O)c21.
What is the InChIKey of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
The InChIKey is HWQQSRVQTHHCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-9-3-2-4-6(9)5(7(10)11)8-12-4/h2-3H2,1H3,(H,10,11).
What are the key properties of 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid?
4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5,6-dihydropyrrolo[2,3-d][1,2]oxazole-3-carboxylic acid is sourced from PubChem (CID 82413478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).