C8H9N3O — CID 82415173
2-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)acetaldehyde (PubChem CID 82415173) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)acetaldehyde.
| Compound Name | 2-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 82415173 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)acetaldehyde |
| SMILES | O=CCN1Cc2cncnc2C1 |
| InChI | InChI=1S/C8H9N3O/c12-2-1-11-4-7-3-9-6-10-8(7)5-11/h2-3,6H,1,4-5H2 |
| InChIKey | DIDJAXPUMOOLJI-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|