About 4-pyrazin-2-yl-1,3-oxazol-5-amine
4-pyrazin-2-yl-1,3-oxazol-5-amine (PubChem CID 82415331) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is 4-pyrazin-2-yl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | 4-pyrazin-2-yl-1,3-oxazol-5-amine |
| PubChem CID | 82415331 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 4-pyrazin-2-yl-1,3-oxazol-5-amine |
| SMILES | Nc1ocnc1-c1cnccn1 |
| InChI | InChI=1S/C7H6N4O/c8-7-6(11-4-12-7)5-3-9-1-2-10-5/h1-4H,8H2 |
| InChIKey | WWCKZDYGWZLNJJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrazin-2-yl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazin-2-yl-1,3-oxazol-5-amine?
The IUPAC name of 4-pyrazin-2-yl-1,3-oxazol-5-amine (CID 82415331) is 4-pyrazin-2-yl-1,3-oxazol-5-amine.
What is the SMILES notation for 4-pyrazin-2-yl-1,3-oxazol-5-amine?
The canonical SMILES for 4-pyrazin-2-yl-1,3-oxazol-5-amine is Nc1ocnc1-c1cnccn1.
What is the InChIKey of 4-pyrazin-2-yl-1,3-oxazol-5-amine?
The InChIKey is WWCKZDYGWZLNJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c8-7-6(11-4-12-7)5-3-9-1-2-10-5/h1-4H,8H2.
What are the key properties of 4-pyrazin-2-yl-1,3-oxazol-5-amine?
4-pyrazin-2-yl-1,3-oxazol-5-amine has a molecular weight of 162.15 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazin-2-yl-1,3-oxazol-5-amine is sourced from PubChem (CID 82415331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).