C7H13N3O — CID 82416305
4-(2-aminoethyl)-3,5-dimethyl-1H-imidazol-2-one (PubChem CID 82416305) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3,5-dimethyl-1H-imidazol-2-one.
| Compound Name | 4-(2-aminoethyl)-3,5-dimethyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 82416305 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 4-(2-aminoethyl)-3,5-dimethyl-1H-imidazol-2-one |
| SMILES | Cc1[nH]c(=O)n(C)c1CCN |
| InChI | InChI=1S/C7H13N3O/c1-5-6(3-4-8)10(2)7(11)9-5/h3-4,8H2,1-2H3,(H,9,11) |
| InChIKey | KQIYMAYAPMQKLP-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |