About 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one
6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one (PubChem CID 118586824) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one.
Analyze 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one?
The IUPAC name of 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one (CID 118586824) is 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one.
What is the SMILES notation for 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one?
The canonical SMILES for 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one is CC1=C(C)NC(=O)NCC1.
What is the InChIKey of 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one?
The InChIKey is ULCGFSWXOYWJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5-3-4-8-7(10)9-6(5)2/h3-4H2,1-2H3,(H2,8,9,10).
What are the key properties of 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one?
6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one has a molecular weight of 140.19 g/mol, XLogP of 0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1,3,4,5-tetrahydro-1,3-diazepin-2-one is sourced from PubChem (CID 118586824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).