C8H14N2O — CID 174307457
5,6-diethyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 174307457) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 5,6-diethyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5,6-diethyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 174307457 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 5,6-diethyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CCC1=C(CC)NC(=O)NC1 |
| InChI | InChI=1S/C8H14N2O/c1-3-6-5-9-8(11)10-7(6)4-2/h3-5H2,1-2H3,(H2,9,10,11) |
| InChIKey | IRNWJLZXHPUYGW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |