C6H13N2O2P — CID 175109372
1,3-diazinane-2,4-dione;ethylphosphane (PubChem CID 175109372) has the molecular formula C6H13N2O2P and a molecular weight of 176.16 g/mol. Its IUPAC name is 1,3-diazinane-2,4-dione;ethylphosphane.
| Compound Name | 1,3-diazinane-2,4-dione;ethylphosphane |
|---|---|
| PubChem CID | 175109372 |
| Molecular Formula | C6H13N2O2P |
| Molecular Weight | 176.16 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 1,3-diazinane-2,4-dione;ethylphosphane |
| SMILES | CCP.O=C1CCNC(=O)N1 |
| InChI | InChI=1S/C4H6N2O2.C2H7P/c7-3-1-2-5-4(8)6-3;1-2-3/h1-2H2,(H2,5,6,7,8);2-3H2,1H3 |
| InChIKey | OAJQQQNZOXVRJX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|