About 4-propyloxan-3-amine
4-propyloxan-3-amine (PubChem CID 82417869) has the molecular formula C8H17NO
and a molecular weight of 143.23 g/mol. Its IUPAC name is 4-propyloxan-3-amine.
Molecular Properties
| Compound Name | 4-propyloxan-3-amine |
| PubChem CID | 82417869 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 4-propyloxan-3-amine |
| SMILES | CCCC1CCOCC1N |
| InChI | InChI=1S/C8H17NO/c1-2-3-7-4-5-10-6-8(7)9/h7-8H,2-6,9H2,1H3 |
| InChIKey | RYIQXKHHTPANQR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyloxan-3-amine?
The IUPAC name of 4-propyloxan-3-amine (CID 82417869) is 4-propyloxan-3-amine.
What is the SMILES notation for 4-propyloxan-3-amine?
The canonical SMILES for 4-propyloxan-3-amine is CCCC1CCOCC1N.
What is the InChIKey of 4-propyloxan-3-amine?
The InChIKey is RYIQXKHHTPANQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO/c1-2-3-7-4-5-10-6-8(7)9/h7-8H,2-6,9H2,1H3.
What are the key properties of 4-propyloxan-3-amine?
4-propyloxan-3-amine has a molecular weight of 143.23 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyloxan-3-amine is sourced from PubChem (CID 82417869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).