C8H15NO — CID 82418034
2-methyl-1,2,3,3a,4,6,7,7a-octahydropyrano[4,3-b]pyrrole (PubChem CID 82418034) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 2-methyl-1,2,3,3a,4,6,7,7a-octahydropyrano[4,3-b]pyrrole.
| Compound Name | 2-methyl-1,2,3,3a,4,6,7,7a-octahydropyrano[4,3-b]pyrrole |
|---|---|
| PubChem CID | 82418034 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2-methyl-1,2,3,3a,4,6,7,7a-octahydropyrano[4,3-b]pyrrole |
| SMILES | CC1CC2COCCC2N1 |
| InChI | InChI=1S/C8H15NO/c1-6-4-7-5-10-3-2-8(7)9-6/h6-9H,2-5H2,1H3 |
| InChIKey | WZIBSLBANFMMLF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |