C5H9NO — CID 55298686
(1R,6R)-3-oxa-7-azabicyclo[4.1.0]heptane (PubChem CID 55298686) has the molecular formula C5H9NO and a molecular weight of 99.13 g/mol. Its IUPAC name is (1R,6R)-3-oxa-7-azabicyclo[4.1.0]heptane.
| Compound Name | (1R,6R)-3-oxa-7-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 55298686 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | (1R,6R)-3-oxa-7-azabicyclo[4.1.0]heptane |
| SMILES | C1C[C@H]2N[C@H]2CO1 |
| InChI | InChI=1S/C5H9NO/c1-2-7-3-5-4(1)6-5/h4-6H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | DIUNZTQKLKGEBB-UHNVWZDZSA-N |
| XLogP | -0.25 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|