About 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine
2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine (PubChem CID 82418523) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine.
Analyze 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine (CID 82418523) is 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine is Cn1cc2c(n1)CNCC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
The InChIKey is FZZXGYLVQRHUIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3/c1-10-5-6-2-3-8-4-7(6)9-10/h5,8H,2-4H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine?
2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine has a molecular weight of 137.19 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydropyrazolo[3,4-c]pyridine is sourced from PubChem (CID 82418523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).