About 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole
2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole (PubChem CID 82418938) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole.
Analyze 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole?
The IUPAC name of 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole (CID 82418938) is 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole.
What is the SMILES notation for 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole?
The canonical SMILES for 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole is Cc1cc2c([nH]1)CNC2.
What is the InChIKey of 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole?
The InChIKey is QKNRINHNALCENE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-5-2-6-3-8-4-7(6)9-5/h2,8-9H,3-4H2,1H3.
What are the key properties of 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole?
2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole has a molecular weight of 122.17 g/mol, XLogP of 0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,4,5,6-tetrahydropyrrolo[3,4-b]pyrrole is sourced from PubChem (CID 82418938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).