C13H8ClF2NO2 — CID 82420815
1-(2,6-difluorophenyl)-6-methyl-4-oxopyridine-3-carbonyl chloride (PubChem CID 82420815) has the molecular formula C13H8ClF2NO2 and a molecular weight of 283.66 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-6-methyl-4-oxopyridine-3-carbonyl chloride.
| Compound Name | 1-(2,6-difluorophenyl)-6-methyl-4-oxopyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 82420815 |
| Molecular Formula | C13H8ClF2NO2 |
| Molecular Weight | 283.66 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-(2,6-difluorophenyl)-6-methyl-4-oxopyridine-3-carbonyl chloride |
| SMILES | Cc1cc(=O)c(C(=O)Cl)cn1-c1c(F)cccc1F |
| InChI | InChI=1S/C13H8ClF2NO2/c1-7-5-11(18)8(13(14)19)6-17(7)12-9(15)3-2-4-10(12)16/h2-6H,1H3 |
| InChIKey | IJCRNHKKGLHANC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.66 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|