C19H26N2O — CID 82421165
5-(butylaminomethyl)-1-(3,4-dimethylphenyl)-2-methylpyridin-4-one (PubChem CID 82421165) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 5-(butylaminomethyl)-1-(3,4-dimethylphenyl)-2-methylpyridin-4-one.
| Compound Name | 5-(butylaminomethyl)-1-(3,4-dimethylphenyl)-2-methylpyridin-4-one |
|---|---|
| PubChem CID | 82421165 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 5-(butylaminomethyl)-1-(3,4-dimethylphenyl)-2-methylpyridin-4-one |
| SMILES | CCCCNCc1cn(-c2ccc(C)c(C)c2)c(C)cc1=O |
| InChI | InChI=1S/C19H26N2O/c1-5-6-9-20-12-17-13-21(16(4)11-19(17)22)18-8-7-14(2)15(3)10-18/h7-8,10-11,13,20H,5-6,9,12H2,1-4H3 |
| InChIKey | XWDCVJJWJLUKEV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|