C17H20F2N2O — CID 82421579
5-(butylaminomethyl)-1-(2,5-difluorophenyl)-2-methylpyridin-4-one (PubChem CID 82421579) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is 5-(butylaminomethyl)-1-(2,5-difluorophenyl)-2-methylpyridin-4-one.
| Compound Name | 5-(butylaminomethyl)-1-(2,5-difluorophenyl)-2-methylpyridin-4-one |
|---|---|
| PubChem CID | 82421579 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-(butylaminomethyl)-1-(2,5-difluorophenyl)-2-methylpyridin-4-one |
| SMILES | CCCCNCc1cn(-c2cc(F)ccc2F)c(C)cc1=O |
| InChI | InChI=1S/C17H20F2N2O/c1-3-4-7-20-10-13-11-21(12(2)8-17(13)22)16-9-14(18)5-6-15(16)19/h5-6,8-9,11,20H,3-4,7,10H2,1-2H3 |
| InChIKey | WWTRGMAACSRJBH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|