C16H19F2N3O — CID 82421607
3-(butylaminomethyl)-1-(2,5-difluorophenyl)-6-methylpyridazin-4-one (PubChem CID 82421607) has the molecular formula C16H19F2N3O and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-(butylaminomethyl)-1-(2,5-difluorophenyl)-6-methylpyridazin-4-one.
| Compound Name | 3-(butylaminomethyl)-1-(2,5-difluorophenyl)-6-methylpyridazin-4-one |
|---|---|
| PubChem CID | 82421607 |
| Molecular Formula | C16H19F2N3O |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-(butylaminomethyl)-1-(2,5-difluorophenyl)-6-methylpyridazin-4-one |
| SMILES | CCCCNCc1nn(-c2cc(F)ccc2F)c(C)cc1=O |
| InChI | InChI=1S/C16H19F2N3O/c1-3-4-7-19-10-14-16(22)8-11(2)21(20-14)15-9-12(17)5-6-13(15)18/h5-6,8-9,19H,3-4,7,10H2,1-2H3 |
| InChIKey | DNAPBXIDNRVMJB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|