C15H17F2N3O2 — CID 82420959
1-(3,4-difluorophenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one (PubChem CID 82420959) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one.
| Compound Name | 1-(3,4-difluorophenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one |
|---|---|
| PubChem CID | 82420959 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one |
| SMILES | COCCNCc1nn(-c2ccc(F)c(F)c2)c(C)cc1=O |
| InChI | InChI=1S/C15H17F2N3O2/c1-10-7-15(21)14(9-18-5-6-22-2)19-20(10)11-3-4-12(16)13(17)8-11/h3-4,7-8,18H,5-6,9H2,1-2H3 |
| InChIKey | NWLMCLAEBWZCHI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|