C17H23N3O2 — CID 82420277
1-(2,6-dimethylphenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one (PubChem CID 82420277) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one |
|---|---|
| PubChem CID | 82420277 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(2-methoxyethylamino)methyl]-6-methylpyridazin-4-one |
| SMILES | COCCNCc1nn(-c2c(C)cccc2C)c(C)cc1=O |
| InChI | InChI=1S/C17H23N3O2/c1-12-6-5-7-13(2)17(12)20-14(3)10-16(21)15(19-20)11-18-8-9-22-4/h5-7,10,18H,8-9,11H2,1-4H3 |
| InChIKey | NIZXCKLUXJRURJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|