C15H11F2NO3 — CID 82421517
(E)-3-[1-(2,4-difluorophenyl)-6-methyl-4-oxo-3-pyridinyl]prop-2-enoic acid (PubChem CID 82421517) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is (E)-3-[1-(2,4-difluorophenyl)-6-methyl-4-oxo-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(2,4-difluorophenyl)-6-methyl-4-oxo-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82421517 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (E)-3-[1-(2,4-difluorophenyl)-6-methyl-4-oxo-3-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1cc(=O)c(/C=C/C(=O)O)cn1-c1ccc(F)cc1F |
| InChI | InChI=1S/C15H11F2NO3/c1-9-6-14(19)10(2-5-15(20)21)8-18(9)13-4-3-11(16)7-12(13)17/h2-8H,1H3,(H,20,21)/b5-2+ |
| InChIKey | IOBIFVXBWZURQN-GORDUTHDSA-N |
| XLogP | 2.52 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|