C11H16N4OS2 — CID 82422489
N-(2-methoxyethyl)-5-(2-propyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 82422489) has the molecular formula C11H16N4OS2 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-(2-propyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-5-(2-propyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82422489 |
| Molecular Formula | C11H16N4OS2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-methoxyethyl)-5-(2-propyl-1,3-thiazol-5-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCCc1ncc(-c2nnc(NCCOC)s2)s1 |
| InChI | InChI=1S/C11H16N4OS2/c1-3-4-9-13-7-8(17-9)10-14-15-11(18-10)12-5-6-16-2/h7H,3-6H2,1-2H3,(H,12,15) |
| InChIKey | DQMDRLGHWFDTHH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|