C10H14N4OS2 — CID 82428087
5-(4-ethyl-1,3-thiazol-5-yl)-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 82428087) has the molecular formula C10H14N4OS2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 5-(4-ethyl-1,3-thiazol-5-yl)-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-ethyl-1,3-thiazol-5-yl)-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82428087 |
| Molecular Formula | C10H14N4OS2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 5-(4-ethyl-1,3-thiazol-5-yl)-N-(2-methoxyethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCc1ncsc1-c1nnc(NCCOC)s1 |
| InChI | InChI=1S/C10H14N4OS2/c1-3-7-8(16-6-12-7)9-13-14-10(17-9)11-4-5-15-2/h6H,3-5H2,1-2H3,(H,11,14) |
| InChIKey | ZGRAAJTVHJKMPH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|