C13H18N4O3S — CID 82526499
1-(2-methoxyethyl)-3-[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]pyridin-2-one (PubChem CID 82526499) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]pyridin-2-one.
| Compound Name | 1-(2-methoxyethyl)-3-[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 82526499 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]pyridin-2-one |
| SMILES | COCCNc1nnc(-c2cccn(CCOC)c2=O)s1 |
| InChI | InChI=1S/C13H18N4O3S/c1-19-8-5-14-13-16-15-11(21-13)10-4-3-6-17(12(10)18)7-9-20-2/h3-4,6H,5,7-9H2,1-2H3,(H,14,16) |
| InChIKey | NQEHQOOSTUZKTQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|