C14H19N3O2S — CID 82526345
3-[2-(ethylamino)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)pyridin-2-one (PubChem CID 82526345) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-[2-(ethylamino)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)pyridin-2-one.
| Compound Name | 3-[2-(ethylamino)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)pyridin-2-one |
|---|---|
| PubChem CID | 82526345 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-[2-(ethylamino)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)pyridin-2-one |
| SMILES | CCNc1nc(-c2cccn(CCCOC)c2=O)cs1 |
| InChI | InChI=1S/C14H19N3O2S/c1-3-15-14-16-12(10-20-14)11-6-4-7-17(13(11)18)8-5-9-19-2/h4,6-7,10H,3,5,8-9H2,1-2H3,(H,15,16) |
| InChIKey | ITXZJAPVHSGBGA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|