C12H10N4OS2 — CID 82422727
5-[2-(phenoxymethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 82422727) has the molecular formula C12H10N4OS2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-[2-(phenoxymethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-[2-(phenoxymethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 82422727 |
| Molecular Formula | C12H10N4OS2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 5-[2-(phenoxymethyl)-1,3-thiazol-5-yl]-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2cnc(COc3ccccc3)s2)[nH][nH]1 |
| InChI | InChI=1S/C12H10N4OS2/c18-12-14-11(15-16-12)9-6-13-10(19-9)7-17-8-4-2-1-3-5-8/h1-6H,7H2,(H2,14,15,16,18) |
| InChIKey | JEHBOSFZDWSKFA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|