C9H16N2O3S2 — CID 82423390
2-methoxy-N-[[2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 82423390) has the molecular formula C9H16N2O3S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-methoxy-N-[[2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 82423390 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-methoxy-N-[[2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1cnc(CS(C)(=O)=O)s1 |
| InChI | InChI=1S/C9H16N2O3S2/c1-14-4-3-10-5-8-6-11-9(15-8)7-16(2,12)13/h6,10H,3-5,7H2,1-2H3 |
| InChIKey | NAJSCPAXJZCVNI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|