2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid

C15H17NO3S — CID 82423868

IUPAC2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid
SMILESCCc1cccc(OCCc2ncc(CC(=O)O)s2)c1
InChIInChI=1S/C15H17NO3S/c1-2-11-4-3-5-12(8-11)19-7-6-14-16-10-13(20-14)9-15(17)18/h3-5,8,10H,2,6-7,9H2,1H3,(H,17,18)
InChIKeyNPTMTGHLRDEDDV-UHFFFAOYSA-N
MW291.37 g/mol
LogP2.95
Rot. Bonds7

About 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid

2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid (PubChem CID 82423868) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid
PubChem CID82423868
Molecular FormulaC15H17NO3S
Molecular Weight291.37 g/mol
Exact Mass291.09
IUPAC Name2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid
SMILESCCc1cccc(OCCc2ncc(CC(=O)O)s2)c1
InChIInChI=1S/C15H17NO3S/c1-2-11-4-3-5-12(8-11)19-7-6-14-16-10-13(20-14)9-15(17)18/h3-5,8,10H,2,6-7,9H2,1H3,(H,17,18)
InChIKeyNPTMTGHLRDEDDV-UHFFFAOYSA-N
XLogP2.95
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.37
LogP ≤ 52.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid (CID 82423868) is 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid is CCc1cccc(OCCc2ncc(CC(=O)O)s2)c1.
What is the InChIKey of 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid?
The InChIKey is NPTMTGHLRDEDDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-2-11-4-3-5-12(8-11)19-7-6-14-16-10-13(20-14)9-15(17)18/h3-5,8,10H,2,6-7,9H2,1H3,(H,17,18).
What are the key properties of 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid?
2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid has a molecular weight of 291.37 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(3-ethylphenoxy)ethyl]-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 82423868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).